![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Ballistic molecular transport through twodimensional Nature 2018.pdf | 2018-07-19 08:15 | 5.0M | |
| Frictionless when flat.pdf | 2018-07-19 08:14 | 221K | |
| Friction on the atomic scale Krim SA 1998.pdf | 2013-11-18 11:20 | 1.0M | |
| Nanophysics_ Microscopic friction emulators_Nature 2015.pdf | 2016-10-05 17:17 | 418K | |
| PTO000022.pdf | 2013-11-18 11:30 | 1.8M | |
| PhysRevLett.111.126103.pdf | 2013-10-04 09:24 | 1.1M | |
| Tarcie na poziomie atomowym.pdf | 2013-11-18 11:35 | 291K | |
| The renaissance of friction_Nat mat 2010.pdf | 2016-10-05 08:03 | 277K | |
| Viewpoint_ Friction at the atomic scale.pdf | 2013-11-18 12:01 | 2.9M | |
| przeplyw gazu | 2018-07-19 08:25 | 316 | |
| tarcie.doc | 2018-10-05 08:01 | 25K | |
| tarcie_artykul niewiadomego pochodzenia.doc | 2013-11-18 11:33 | 50K | |
| tarcie_info_Nature 2013.pdf | 2013-10-04 09:24 | 237K | |